C10H6N6O5 — CID 10684890
4-hydroxy-7-nitro-6-(1,2,4-triazol-1-yl)-1H-quinoxaline-2,3-dione (PubChem CID 10684890) has the molecular formula C10H6N6O5 and a molecular weight of 290.20 g/mol. Its IUPAC name is 4-hydroxy-7-nitro-6-(1,2,4-triazol-1-yl)-1H-quinoxaline-2,3-dione.
| Compound Name | 4-hydroxy-7-nitro-6-(1,2,4-triazol-1-yl)-1H-quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10684890 |
| Molecular Formula | C10H6N6O5 |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 4-hydroxy-7-nitro-6-(1,2,4-triazol-1-yl)-1H-quinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])c(-n3cncn3)cc2n(O)c1=O |
| InChI | InChI=1S/C10H6N6O5/c17-9-10(18)15(19)6-2-7(14-4-11-3-12-14)8(16(20)21)1-5(6)13-9/h1-4,19H,(H,13,17) |
| InChIKey | WEALAXMZWOZCHH-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|