C14H17NS2 — CID 106850212
2-(4-ethylsulfanylphenyl)-5-propan-2-yl-1,3-thiazole (PubChem CID 106850212) has the molecular formula C14H17NS2 and a molecular weight of 263.43 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-5-propan-2-yl-1,3-thiazole.
| Compound Name | 2-(4-ethylsulfanylphenyl)-5-propan-2-yl-1,3-thiazole |
|---|---|
| PubChem CID | 106850212 |
| Molecular Formula | C14H17NS2 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2-(4-ethylsulfanylphenyl)-5-propan-2-yl-1,3-thiazole |
| SMILES | CCSc1ccc(-c2ncc(C(C)C)s2)cc1 |
| InChI | InChI=1S/C14H17NS2/c1-4-16-12-7-5-11(6-8-12)14-15-9-13(17-14)10(2)3/h5-10H,4H2,1-3H3 |
| InChIKey | ZZRYCBKFGJBVJV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |