C15H18BrNO — CID 106851480
(2-bromofuran-3-yl)-(2,3,5,6-tetramethylphenyl)methanamine (PubChem CID 106851480) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-(2,3,5,6-tetramethylphenyl)methanamine.
| Compound Name | (2-bromofuran-3-yl)-(2,3,5,6-tetramethylphenyl)methanamine |
|---|---|
| PubChem CID | 106851480 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | (2-bromofuran-3-yl)-(2,3,5,6-tetramethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C)c(C(N)c2ccoc2Br)c1C |
| InChI | InChI=1S/C15H18BrNO/c1-8-7-9(2)11(4)13(10(8)3)14(17)12-5-6-18-15(12)16/h5-7,14H,17H2,1-4H3 |
| InChIKey | QBRMCTDJCUWDHF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |