C14H15Br2NO2 — CID 106851843
1-(2-bromofuran-3-yl)-1-(5-bromo-2-methoxy-4-methylphenyl)-N-methylmethanamine (PubChem CID 106851843) has the molecular formula C14H15Br2NO2 and a molecular weight of 389.09 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methoxy-4-methylphenyl)-N-methylmethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methoxy-4-methylphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 106851843 |
| Molecular Formula | C14H15Br2NO2 |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-1-(5-bromo-2-methoxy-4-methylphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(Br)c(C)cc1OC)c1ccoc1Br |
| InChI | InChI=1S/C14H15Br2NO2/c1-8-6-12(18-3)10(7-11(8)15)13(17-2)9-4-5-19-14(9)16/h4-7,13,17H,1-3H3 |
| InChIKey | YHQDSKMLWTUKFR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |