About 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine
3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine (PubChem CID 10685233) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine.
Molecular Properties
| Compound Name | 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine |
| PubChem CID | 10685233 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine |
| SMILES | C(#Cc1cccnc1)CCN1CC=C(c2cccs2)CC1 |
| InChI | InChI=1S/C18H18N2S/c1(5-16-6-3-10-19-15-16)2-11-20-12-8-17(9-13-20)18-7-4-14-21-18/h3-4,6-8,10,14-15H,2,9,11-13H2 |
| InChIKey | JLTOBYGAYFPXPN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine?
The IUPAC name of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine (CID 10685233) is 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine.
What is the SMILES notation for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine?
The canonical SMILES for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine is C(#Cc1cccnc1)CCN1CC=C(c2cccs2)CC1.
What is the InChIKey of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine?
The InChIKey is JLTOBYGAYFPXPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S/c1(5-16-6-3-10-19-15-16)2-11-20-12-8-17(9-13-20)18-7-4-14-21-18/h3-4,6-8,10,14-15H,2,9,11-13H2.
What are the key properties of 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine?
3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine has a molecular weight of 294.42 g/mol, XLogP of 3.67, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-thiophen-2-yl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridine is sourced from PubChem (CID 10685233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).