C17H30N2O2 — CID 10685239
1-pyrrolidin-1-yl-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 10685239) has the molecular formula C17H30N2O2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | 1-pyrrolidin-1-yl-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 10685239 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 1-pyrrolidin-1-yl-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)/C(=N/OCC(O)CN1CCCC1)C2 |
| InChI | InChI=1S/C17H30N2O2/c1-16(2)13-6-7-17(16,3)15(10-13)18-21-12-14(20)11-19-8-4-5-9-19/h13-14,20H,4-12H2,1-3H3/b18-15+/t13-,14?,17+/m0/s1 |
| InChIKey | KBNLLZZCYNKPJK-SCLKBQFFSA-N |
| XLogP | 2.66 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|