C11H6BrCl2NO2 — CID 106852540
2-bromo-N-(2,3-dichlorophenyl)furan-3-carboxamide (PubChem CID 106852540) has the molecular formula C11H6BrCl2NO2 and a molecular weight of 334.98 g/mol. Its IUPAC name is 2-bromo-N-(2,3-dichlorophenyl)furan-3-carboxamide.
| Compound Name | 2-bromo-N-(2,3-dichlorophenyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106852540 |
| Molecular Formula | C11H6BrCl2NO2 |
| Molecular Weight | 334.98 g/mol |
| Exact Mass | 332.90 |
| IUPAC Name | 2-bromo-N-(2,3-dichlorophenyl)furan-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)c1ccoc1Br |
| InChI | InChI=1S/C11H6BrCl2NO2/c12-10-6(4-5-17-10)11(16)15-8-3-1-2-7(13)9(8)14/h1-5H,(H,15,16) |
| InChIKey | FSQYOEIELGEUPN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.98 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |