C20H25NO — CID 10685309
2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-amine (PubChem CID 10685309) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-amine.
| Compound Name | 2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10685309 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-3-(4-methylphenyl)-3H-1-benzofuran-5-amine |
| SMILES | Cc1ccc(C2c3c(C)c(N)c(C)c(C)c3OC2(C)C)cc1 |
| InChI | InChI=1S/C20H25NO/c1-11-7-9-15(10-8-11)17-16-14(4)18(21)12(2)13(3)19(16)22-20(17,5)6/h7-10,17H,21H2,1-6H3 |
| InChIKey | ZTLPMYFAELUOEE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|