C12H16BrNO3 — CID 106853880
(2-bromofuran-3-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone (PubChem CID 106853880) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is (2-bromofuran-3-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone.
| Compound Name | (2-bromofuran-3-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 106853880 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (2-bromofuran-3-yl)-[2-(3-hydroxypropyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccoc1Br)N1CCCC1CCCO |
| InChI | InChI=1S/C12H16BrNO3/c13-11-10(5-8-17-11)12(16)14-6-1-3-9(14)4-2-7-15/h5,8-9,15H,1-4,6-7H2 |
| InChIKey | CCOSJYAJGVBYKA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |