About 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one
3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one (PubChem CID 10685418) has the molecular formula C18H19NO3
and a molecular weight of 297.35 g/mol. Its IUPAC name is 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one.
Molecular Properties
| Compound Name | 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one |
| PubChem CID | 10685418 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one |
| SMILES | CN1C(=O)C(O)C(c2ccccc2)C(c2ccccc2)C1O |
| InChI | InChI=1S/C18H19NO3/c1-19-17(21)15(13-10-6-3-7-11-13)14(16(20)18(19)22)12-8-4-2-5-9-12/h2-11,14-17,20-21H,1H3 |
| InChIKey | FTFQYXRXXIHIHC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one?
The IUPAC name of 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one (CID 10685418) is 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one.
What is the SMILES notation for 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one?
The canonical SMILES for 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one is CN1C(=O)C(O)C(c2ccccc2)C(c2ccccc2)C1O.
What is the InChIKey of 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one?
The InChIKey is FTFQYXRXXIHIHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3/c1-19-17(21)15(13-10-6-3-7-11-13)14(16(20)18(19)22)12-8-4-2-5-9-12/h2-11,14-17,20-21H,1H3.
What are the key properties of 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one?
3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one has a molecular weight of 297.35 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydroxy-1-methyl-4,5-diphenylpiperidin-2-one is sourced from PubChem (CID 10685418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).