About (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one
(3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one (PubChem CID 10685477) has the molecular formula C18H18O4
and a molecular weight of 298.34 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one.
Molecular Properties
| Compound Name | (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one |
| PubChem CID | 10685477 |
| Molecular Formula | C18H18O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one |
| SMILES | O=C1OC[C@H](Cc2cccc(O)c2)[C@H]1Cc1cccc(O)c1 |
| InChI | InChI=1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m0/s1 |
| InChIKey | HVDGDHBAMCBBLR-WMLDXEAASA-N |
| XLogP | 2.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one?
The IUPAC name of (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one (CID 10685477) is (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one.
What is the SMILES notation for (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one?
The canonical SMILES for (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one is O=C1OC[C@H](Cc2cccc(O)c2)[C@H]1Cc1cccc(O)c1.
What is the InChIKey of (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one?
The InChIKey is HVDGDHBAMCBBLR-WMLDXEAASA-N. The full InChI is InChI=1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m0/s1.
What are the key properties of (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one?
(3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one has a molecular weight of 298.34 g/mol, XLogP of 2.67, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one is sourced from PubChem (CID 10685477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).