C12H12BrClN2O — CID 106854830
1-(2-bromofuran-3-yl)-2-(3-chloro-4-pyridinyl)-N-methylethanamine (PubChem CID 106854830) has the molecular formula C12H12BrClN2O and a molecular weight of 315.60 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-2-(3-chloro-4-pyridinyl)-N-methylethanamine.
| Compound Name | 1-(2-bromofuran-3-yl)-2-(3-chloro-4-pyridinyl)-N-methylethanamine |
|---|---|
| PubChem CID | 106854830 |
| Molecular Formula | C12H12BrClN2O |
| Molecular Weight | 315.60 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-2-(3-chloro-4-pyridinyl)-N-methylethanamine |
| SMILES | CNC(Cc1ccncc1Cl)c1ccoc1Br |
| InChI | InChI=1S/C12H12BrClN2O/c1-15-11(9-3-5-17-12(9)13)6-8-2-4-16-7-10(8)14/h2-5,7,11,15H,6H2,1H3 |
| InChIKey | GIYCWBTVJQKSBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |