C10H14BrN3O3 — CID 106855764
N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-2-bromo-N-methylfuran-3-carboxamide (PubChem CID 106855764) has the molecular formula C10H14BrN3O3 and a molecular weight of 304.14 g/mol. Its IUPAC name is N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-2-bromo-N-methylfuran-3-carboxamide.
| Compound Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-2-bromo-N-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106855764 |
| Molecular Formula | C10H14BrN3O3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | N-[(3Z)-3-amino-3-hydroxyimino-2-methylpropyl]-2-bromo-N-methylfuran-3-carboxamide |
| SMILES | CC(CN(C)C(=O)c1ccoc1Br)/C(N)=N/O |
| InChI | InChI=1S/C10H14BrN3O3/c1-6(9(12)13-16)5-14(2)10(15)7-3-4-17-8(7)11/h3-4,6,16H,5H2,1-2H3,(H2,12,13) |
| InChIKey | XVLDZBVHFGOSRI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|