C15H28O4Si — CID 10685646
(4aR,6R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 10685646) has the molecular formula C15H28O4Si and a molecular weight of 300.47 g/mol. Its IUPAC name is (4aR,6R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (4aR,6R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 10685646 |
| Molecular Formula | C15H28O4Si |
| Molecular Weight | 300.47 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (4aR,6R,7S,7aS)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-hydroxy-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H]2COC(=O)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C15H28O4Si/c1-15(2,3)20(4,5)19-9-12-11-8-18-14(17)7-10(11)6-13(12)16/h10-13,16H,6-9H2,1-5H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | ZXULQIQBFMIMGP-YVECIDJPSA-N |
| XLogP | 2.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|