C11H18BrNO — CID 106856891
1-(2-bromofuran-3-yl)-N-ethyl-3-methylbutan-1-amine (PubChem CID 106856891) has the molecular formula C11H18BrNO and a molecular weight of 260.17 g/mol. Its IUPAC name is 1-(2-bromofuran-3-yl)-N-ethyl-3-methylbutan-1-amine.
| Compound Name | 1-(2-bromofuran-3-yl)-N-ethyl-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 106856891 |
| Molecular Formula | C11H18BrNO |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 1-(2-bromofuran-3-yl)-N-ethyl-3-methylbutan-1-amine |
| SMILES | CCNC(CC(C)C)c1ccoc1Br |
| InChI | InChI=1S/C11H18BrNO/c1-4-13-10(7-8(2)3)9-5-6-14-11(9)12/h5-6,8,10,13H,4,7H2,1-3H3 |
| InChIKey | LCQGSCDQOCRBHD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |