C12H16BrN3O — CID 106857638
N-[(2-bromofuran-3-yl)-(2-methylpyrazol-3-yl)methyl]propan-1-amine (PubChem CID 106857638) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is N-[(2-bromofuran-3-yl)-(2-methylpyrazol-3-yl)methyl]propan-1-amine.
| Compound Name | N-[(2-bromofuran-3-yl)-(2-methylpyrazol-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 106857638 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | N-[(2-bromofuran-3-yl)-(2-methylpyrazol-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccoc1Br)c1ccnn1C |
| InChI | InChI=1S/C12H16BrN3O/c1-3-6-14-11(9-5-8-17-12(9)13)10-4-7-15-16(10)2/h4-5,7-8,11,14H,3,6H2,1-2H3 |
| InChIKey | IBJBLHVBLGJFMQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |