C19H26O3 — CID 10685783
methyl (4aR,4bS,8aR,10aR)-1,4a,7-trimethyl-8-oxo-4,4b,5,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate (PubChem CID 10685783) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is methyl (4aR,4bS,8aR,10aR)-1,4a,7-trimethyl-8-oxo-4,4b,5,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate.
| Compound Name | methyl (4aR,4bS,8aR,10aR)-1,4a,7-trimethyl-8-oxo-4,4b,5,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 10685783 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (4aR,4bS,8aR,10aR)-1,4a,7-trimethyl-8-oxo-4,4b,5,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@@H]3C(C)=CCC[C@@]3(C)[C@@H]1CC=C(C)C2=O |
| InChI | InChI=1S/C19H26O3/c1-12-6-5-10-18(3)14(12)9-11-19(17(21)22-4)15(18)8-7-13(2)16(19)20/h6-7,14-15H,5,8-11H2,1-4H3/t14-,15+,18-,19-/m1/s1 |
| InChIKey | YWANSVDWDBMDQU-WTLGNFPFSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|