C16H24BrNO2S — CID 106858272
N-[(2-bromofuran-3-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]ethanamine (PubChem CID 106858272) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is N-[(2-bromofuran-3-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-bromofuran-3-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 106858272 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[(2-bromofuran-3-yl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]ethanamine |
| SMILES | CCNC(c1ccoc1Br)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C16H24BrNO2S/c1-2-18-14(13-4-7-19-15(13)17)12-3-8-20-16(11-12)5-9-21-10-6-16/h4,7,12,14,18H,2-3,5-6,8-11H2,1H3 |
| InChIKey | LZWRJPNFJJJKIV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |