C14H17Cl2N3 — CID 106858641
(2-chloro-4-methylphenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine (PubChem CID 106858641) has the molecular formula C14H17Cl2N3 and a molecular weight of 298.22 g/mol. Its IUPAC name is (2-chloro-4-methylphenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine.
| Compound Name | (2-chloro-4-methylphenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
|---|---|
| PubChem CID | 106858641 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2-chloro-4-methylphenyl)-(4-chloro-1-propan-2-ylpyrazol-5-yl)methanamine |
| SMILES | Cc1ccc(C(N)c2c(Cl)cnn2C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2N3/c1-8(2)19-14(12(16)7-18-19)13(17)10-5-4-9(3)6-11(10)15/h4-8,13H,17H2,1-3H3 |
| InChIKey | XFHLNSNMCIMOLQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |