C15H13Cl3O — CID 106859115
1-(2-chloro-4-methylphenyl)-2-(2,6-dichlorophenyl)ethanol (PubChem CID 106859115) has the molecular formula C15H13Cl3O and a molecular weight of 315.63 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-2-(2,6-dichlorophenyl)ethanol.
| Compound Name | 1-(2-chloro-4-methylphenyl)-2-(2,6-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 106859115 |
| Molecular Formula | C15H13Cl3O |
| Molecular Weight | 315.63 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-2-(2,6-dichlorophenyl)ethanol |
| SMILES | Cc1ccc(C(O)Cc2c(Cl)cccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl3O/c1-9-5-6-10(14(18)7-9)15(19)8-11-12(16)3-2-4-13(11)17/h2-7,15,19H,8H2,1H3 |
| InChIKey | PPISHTHLXHJATG-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |