About [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate
[2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate (PubChem CID 10685934) has the molecular formula C18H24O4
and a molecular weight of 304.39 g/mol. Its IUPAC name is [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate.
Molecular Properties
| Compound Name | [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate |
| PubChem CID | 10685934 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C18H24O4/c1-11(19)21-9-15(20)12-7-13(17(2,3)4)16-14(8-12)18(5,6)10-22-16/h7-8H,9-10H2,1-6H3 |
| InChIKey | MOXCJMYMBPJGRD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate?
The IUPAC name of [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate (CID 10685934) is [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate.
What is the SMILES notation for [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate?
The canonical SMILES for [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate is CC(=O)OCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2.
What is the InChIKey of [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate?
The InChIKey is MOXCJMYMBPJGRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O4/c1-11(19)21-9-15(20)12-7-13(17(2,3)4)16-14(8-12)18(5,6)10-22-16/h7-8H,9-10H2,1-6H3.
What are the key properties of [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate?
[2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate has a molecular weight of 304.39 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-2-oxoethyl] acetate is sourced from PubChem (CID 10685934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).