C17H24O3Si — CID 10685962
methyl (1S,2S,3R)-2-(2-methoxyphenyl)-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate (PubChem CID 10685962) has the molecular formula C17H24O3Si and a molecular weight of 304.46 g/mol. Its IUPAC name is methyl (1S,2S,3R)-2-(2-methoxyphenyl)-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate.
| Compound Name | methyl (1S,2S,3R)-2-(2-methoxyphenyl)-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10685962 |
| Molecular Formula | C17H24O3Si |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | methyl (1S,2S,3R)-2-(2-methoxyphenyl)-3-[(E)-2-trimethylsilylethenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](/C=C/[Si](C)(C)C)[C@@H]1c1ccccc1OC |
| InChI | InChI=1S/C17H24O3Si/c1-19-14-9-7-6-8-12(14)15-13(10-11-21(3,4)5)16(15)17(18)20-2/h6-11,13,15-16H,1-5H3/b11-10+/t13-,15+,16+/m1/s1 |
| InChIKey | FOTFOUGJDIDMBL-MRQJWXRISA-N |
| XLogP | 3.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|