C9H10Br2N4O — CID 106860278
[(2-bromofuran-3-yl)-(4-bromo-1-methylpyrazol-5-yl)methyl]hydrazine (PubChem CID 106860278) has the molecular formula C9H10Br2N4O and a molecular weight of 350.01 g/mol. Its IUPAC name is [(2-bromofuran-3-yl)-(4-bromo-1-methylpyrazol-5-yl)methyl]hydrazine.
| Compound Name | [(2-bromofuran-3-yl)-(4-bromo-1-methylpyrazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 106860278 |
| Molecular Formula | C9H10Br2N4O |
| Molecular Weight | 350.01 g/mol |
| Exact Mass | 347.92 |
| IUPAC Name | [(2-bromofuran-3-yl)-(4-bromo-1-methylpyrazol-5-yl)methyl]hydrazine |
| SMILES | Cn1ncc(Br)c1C(NN)c1ccoc1Br |
| InChI | InChI=1S/C9H10Br2N4O/c1-15-8(6(10)4-13-15)7(14-12)5-2-3-16-9(5)11/h2-4,7,14H,12H2,1H3 |
| InChIKey | COKSJSHZKDPKJH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.01 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|