About 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine
1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine (PubChem CID 10686061) has the molecular formula C19H27N
and a molecular weight of 269.43 g/mol. Its IUPAC name is 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine |
| PubChem CID | 10686061 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine |
| SMILES | CC1(C)CCCN(CCCC2=CCc3ccccc32)C1 |
| InChI | InChI=1S/C19H27N/c1-19(2)12-6-14-20(15-19)13-5-8-17-11-10-16-7-3-4-9-18(16)17/h3-4,7,9,11H,5-6,8,10,12-15H2,1-2H3 |
| InChIKey | KAFCLZVKMJZLJA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine?
The IUPAC name of 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine (CID 10686061) is 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine.
What is the SMILES notation for 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine?
The canonical SMILES for 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine is CC1(C)CCCN(CCCC2=CCc3ccccc32)C1.
What is the InChIKey of 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine?
The InChIKey is KAFCLZVKMJZLJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N/c1-19(2)12-6-14-20(15-19)13-5-8-17-11-10-16-7-3-4-9-18(16)17/h3-4,7,9,11H,5-6,8,10,12-15H2,1-2H3.
What are the key properties of 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine?
1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine has a molecular weight of 269.43 g/mol, XLogP of 4.53, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3H-inden-1-yl)propyl]-3,3-dimethylpiperidine is sourced from PubChem (CID 10686061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).