C16H18ClNO3 — CID 10686202
(2S,7aR)-7a-(4-chlorophenyl)-2-(prop-2-enoxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 10686202) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (2S,7aR)-7a-(4-chlorophenyl)-2-(prop-2-enoxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (2S,7aR)-7a-(4-chlorophenyl)-2-(prop-2-enoxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10686202 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (2S,7aR)-7a-(4-chlorophenyl)-2-(prop-2-enoxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | C=CCOC[C@@H]1CN2C(=O)CC[C@]2(c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C16H18ClNO3/c1-2-9-20-11-14-10-18-15(19)7-8-16(18,21-14)12-3-5-13(17)6-4-12/h2-6,14H,1,7-11H2/t14-,16+/m0/s1 |
| InChIKey | YRFYVFGGIGLETA-GOEBONIOSA-N |
| XLogP | 2.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|