C13H17ClN2O — CID 106862663
5-[(2-chloro-4-methylphenyl)methylamino]piperidin-2-one (PubChem CID 106862663) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 5-[(2-chloro-4-methylphenyl)methylamino]piperidin-2-one.
| Compound Name | 5-[(2-chloro-4-methylphenyl)methylamino]piperidin-2-one |
|---|---|
| PubChem CID | 106862663 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 5-[(2-chloro-4-methylphenyl)methylamino]piperidin-2-one |
| SMILES | Cc1ccc(CNC2CCC(=O)NC2)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O/c1-9-2-3-10(12(14)6-9)7-15-11-4-5-13(17)16-8-11/h2-3,6,11,15H,4-5,7-8H2,1H3,(H,16,17) |
| InChIKey | NTBZDCWDYCKKKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |