C8H12ClF3N2O5 — CID 10686272
(3R,4R,5R,6S)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidin-1-ium-3-carboxylic acid chloride (PubChem CID 10686272) has the molecular formula C8H12ClF3N2O5 and a molecular weight of 308.64 g/mol. Its IUPAC name is (3R,4R,5R,6S)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidin-1-ium-3-carboxylic acid chloride.
| Compound Name | (3R,4R,5R,6S)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidin-1-ium-3-carboxylic acid chloride |
|---|---|
| PubChem CID | 10686272 |
| Molecular Formula | C8H12ClF3N2O5 |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (3R,4R,5R,6S)-4,5-dihydroxy-6-[(2,2,2-trifluoroacetyl)amino]piperidin-1-ium-3-carboxylic acid chloride |
| SMILES | O=C(O)[C@@H]1C[NH2+][C@H](NC(=O)C(F)(F)F)[C@@H](O)[C@@H]1O.[Cl-] |
| InChI | InChI=1S/C8H11F3N2O5.ClH/c9-8(10,11)7(18)13-5-4(15)3(14)2(1-12-5)6(16)17;/h2-5,12,14-15H,1H2,(H,13,18)(H,16,17);1H/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | ZHKXLLZXWMUZQL-JJKGCWMISA-N |
| XLogP | -6.01 |
| TPSA | 123.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | -6.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |