C15H12Cl2F2 — CID 106863202
1-[chloro-(2-chloro-4-methylphenyl)methyl]-2,4-difluoro-5-methylbenzene (PubChem CID 106863202) has the molecular formula C15H12Cl2F2 and a molecular weight of 301.16 g/mol. Its IUPAC name is 1-[chloro-(2-chloro-4-methylphenyl)methyl]-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-[chloro-(2-chloro-4-methylphenyl)methyl]-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 106863202 |
| Molecular Formula | C15H12Cl2F2 |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 1-[chloro-(2-chloro-4-methylphenyl)methyl]-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1ccc(C(Cl)c2cc(C)c(F)cc2F)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2F2/c1-8-3-4-10(12(16)5-8)15(17)11-6-9(2)13(18)7-14(11)19/h3-7,15H,1-2H3 |
| InChIKey | WWWILKRELHXDTN-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|