C14H21ClN2S — CID 106863520
3-[(2-chloro-4-methylphenyl)methyl-propan-2-ylamino]propanethioamide (PubChem CID 106863520) has the molecular formula C14H21ClN2S and a molecular weight of 284.86 g/mol. Its IUPAC name is 3-[(2-chloro-4-methylphenyl)methyl-propan-2-ylamino]propanethioamide.
| Compound Name | 3-[(2-chloro-4-methylphenyl)methyl-propan-2-ylamino]propanethioamide |
|---|---|
| PubChem CID | 106863520 |
| Molecular Formula | C14H21ClN2S |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 3-[(2-chloro-4-methylphenyl)methyl-propan-2-ylamino]propanethioamide |
| SMILES | Cc1ccc(CN(CCC(N)=S)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H21ClN2S/c1-10(2)17(7-6-14(16)18)9-12-5-4-11(3)8-13(12)15/h4-5,8,10H,6-7,9H2,1-3H3,(H2,16,18) |
| InChIKey | GTWKHNRYAVRXTC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|