C16H16N4O3 — CID 10686540
2,4-dimethyl-2-(4-nitrophenyl)-1,3-dihydro-1,3,4-benzotriazepin-5-one (PubChem CID 10686540) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2,4-dimethyl-2-(4-nitrophenyl)-1,3-dihydro-1,3,4-benzotriazepin-5-one.
| Compound Name | 2,4-dimethyl-2-(4-nitrophenyl)-1,3-dihydro-1,3,4-benzotriazepin-5-one |
|---|---|
| PubChem CID | 10686540 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2,4-dimethyl-2-(4-nitrophenyl)-1,3-dihydro-1,3,4-benzotriazepin-5-one |
| SMILES | CN1NC(C)(c2ccc([N+](=O)[O-])cc2)Nc2ccccc2C1=O |
| InChI | InChI=1S/C16H16N4O3/c1-16(11-7-9-12(10-8-11)20(22)23)17-14-6-4-3-5-13(14)15(21)19(2)18-16/h3-10,17-18H,1-2H3 |
| InChIKey | DXIDQNKVGFMOAB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|