About ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate
ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate (PubChem CID 10686584) has the molecular formula C18H32O4
and a molecular weight of 312.45 g/mol. Its IUPAC name is ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate |
| PubChem CID | 10686584 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate |
| SMILES | C=C(O[C@H]1CCCC[C@@H]1O)[C@](CC)(CC(C)C)C(=O)OCC |
| InChI | InChI=1S/C18H32O4/c1-6-18(12-13(3)4,17(20)21-7-2)14(5)22-16-11-9-8-10-15(16)19/h13,15-16,19H,5-12H2,1-4H3/t15-,16-,18-/m0/s1 |
| InChIKey | DNFNNBQPYVBUMX-BQFCYCMXSA-N |
| XLogP | 3.83 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate?
The IUPAC name of ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate (CID 10686584) is ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate.
What is the SMILES notation for ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate?
The canonical SMILES for ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate is C=C(O[C@H]1CCCC[C@@H]1O)[C@](CC)(CC(C)C)C(=O)OCC.
What is the InChIKey of ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate?
The InChIKey is DNFNNBQPYVBUMX-BQFCYCMXSA-N. The full InChI is InChI=1S/C18H32O4/c1-6-18(12-13(3)4,17(20)21-7-2)14(5)22-16-11-9-8-10-15(16)19/h13,15-16,19H,5-12H2,1-4H3/t15-,16-,18-/m0/s1.
What are the key properties of ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate?
ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate has a molecular weight of 312.45 g/mol, XLogP of 3.83, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-ethyl-2-[1-[(1S,2S)-2-hydroxycyclohexyl]oxyethenyl]-4-methylpentanoate is sourced from PubChem (CID 10686584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).