C16H22ClN3S — CID 106867932
2-(2-chloro-4-methylphenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine (PubChem CID 106867932) has the molecular formula C16H22ClN3S and a molecular weight of 323.89 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(2-chloro-4-methylphenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 106867932 |
| Molecular Formula | C16H22ClN3S |
| Molecular Weight | 323.89 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine |
| SMILES | CCCc1nnsc1C(Cc1ccc(C)cc1Cl)NCC |
| InChI | InChI=1S/C16H22ClN3S/c1-4-6-14-16(21-20-19-14)15(18-5-2)10-12-8-7-11(3)9-13(12)17/h7-9,15,18H,4-6,10H2,1-3H3 |
| InChIKey | LRMHYCVDSXGLAZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |