C17H26ClNO2 — CID 106868855
2-(2-chloro-4-methylphenyl)-1-(4-ethoxyoxan-4-yl)-N-methylethanamine (PubChem CID 106868855) has the molecular formula C17H26ClNO2 and a molecular weight of 311.85 g/mol. Its IUPAC name is 2-(2-chloro-4-methylphenyl)-1-(4-ethoxyoxan-4-yl)-N-methylethanamine.
| Compound Name | 2-(2-chloro-4-methylphenyl)-1-(4-ethoxyoxan-4-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 106868855 |
| Molecular Formula | C17H26ClNO2 |
| Molecular Weight | 311.85 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 2-(2-chloro-4-methylphenyl)-1-(4-ethoxyoxan-4-yl)-N-methylethanamine |
| SMILES | CCOC1(C(Cc2ccc(C)cc2Cl)NC)CCOCC1 |
| InChI | InChI=1S/C17H26ClNO2/c1-4-21-17(7-9-20-10-8-17)16(19-3)12-14-6-5-13(2)11-15(14)18/h5-6,11,16,19H,4,7-10,12H2,1-3H3 |
| InChIKey | ZIRJMZOFWNRRAH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |