C15H19N5O3 — CID 10686964
benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 10686964) has the molecular formula C15H19N5O3 and a molecular weight of 317.35 g/mol. Its IUPAC name is benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10686964 |
| Molecular Formula | C15H19N5O3 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | benzyl N-[(2S)-1-hydrazinyl-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)[C@@H](Cc1cnc[nH]1)C(=O)NN |
| InChI | InChI=1S/C15H19N5O3/c1-20(15(22)23-9-11-5-3-2-4-6-11)13(14(21)19-16)7-12-8-17-10-18-12/h2-6,8,10,13H,7,9,16H2,1H3,(H,17,18)(H,19,21)/t13-/m0/s1 |
| InChIKey | RLWQSEZTVWSVHA-ZDUSSCGKSA-N |
| XLogP | 0.58 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|