About 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole
5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole (PubChem CID 10687024) has the molecular formula C16H14O5S
and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole |
| PubChem CID | 10687024 |
| Molecular Formula | C16H14O5S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole |
| SMILES | O=S(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H14O5S/c17-22(7-11-1-3-13-15(5-11)20-9-18-13)8-12-2-4-14-16(6-12)21-10-19-14/h1-6H,7-10H2 |
| InChIKey | VUWXEBWKAWKHEG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole?
The IUPAC name of 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole (CID 10687024) is 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole.
What is the SMILES notation for 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole?
The canonical SMILES for 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole is O=S(Cc1ccc2c(c1)OCO2)Cc1ccc2c(c1)OCO2.
What is the InChIKey of 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole?
The InChIKey is VUWXEBWKAWKHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O5S/c17-22(7-11-1-3-13-15(5-11)20-9-18-13)8-12-2-4-14-16(6-12)21-10-19-14/h1-6H,7-10H2.
What are the key properties of 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole?
5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole has a molecular weight of 318.35 g/mol, XLogP of 2.59, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-ylmethylsulfinylmethyl)-1,3-benzodioxole is sourced from PubChem (CID 10687024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).