methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate

C17H34O5 — CID 10687049

IUPACmethyl (9R,10R)-9,10,16-trihydroxyhexadecanoate
SMILESCOC(=O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO
InChIInChI=1S/C17H34O5/c1-22-17(21)13-9-4-2-3-7-11-15(19)16(20)12-8-5-6-10-14-18/h15-16,18-20H,2-14H2,1H3/t15-,16-/m1/s1
InChIKeyRPJKCXYNOLKCID-HZPDHXFCSA-N
MW318.45 g/mol
LogP2.55
Rot. Bonds15

About methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate

methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate (PubChem CID 10687049) has the molecular formula C17H34O5 and a molecular weight of 318.45 g/mol. Its IUPAC name is methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate.

Molecular Properties

Compound Namemethyl (9R,10R)-9,10,16-trihydroxyhexadecanoate
PubChem CID10687049
Molecular FormulaC17H34O5
Molecular Weight318.45 g/mol
Exact Mass318.24
IUPAC Namemethyl (9R,10R)-9,10,16-trihydroxyhexadecanoate
SMILESCOC(=O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO
InChIInChI=1S/C17H34O5/c1-22-17(21)13-9-4-2-3-7-11-15(19)16(20)12-8-5-6-10-14-18/h15-16,18-20H,2-14H2,1H3/t15-,16-/m1/s1
InChIKeyRPJKCXYNOLKCID-HZPDHXFCSA-N
XLogP2.55
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500318.45
LogP ≤ 52.55
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate?
The IUPAC name of methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate (CID 10687049) is methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate.
What is the SMILES notation for methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate?
The canonical SMILES for methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate is COC(=O)CCCCCCC[C@@H](O)[C@H](O)CCCCCCO.
What is the InChIKey of methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate?
The InChIKey is RPJKCXYNOLKCID-HZPDHXFCSA-N. The full InChI is InChI=1S/C17H34O5/c1-22-17(21)13-9-4-2-3-7-11-15(19)16(20)12-8-5-6-10-14-18/h15-16,18-20H,2-14H2,1H3/t15-,16-/m1/s1.
What are the key properties of methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate?
methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate has a molecular weight of 318.45 g/mol, XLogP of 2.55, 15 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (9R,10R)-9,10,16-trihydroxyhexadecanoate is sourced from PubChem (CID 10687049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).