About 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine
2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine (PubChem CID 10687103) has the molecular formula C16H17NO4S
and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine |
| PubChem CID | 10687103 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1cccc2c1S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C16H17NO4S/c1-17(2)10-11-20-13-7-5-8-14-16(13)22(18,19)15-9-4-3-6-12(15)21-14/h3-9H,10-11H2,1-2H3 |
| InChIKey | WNSRLYMBOYSDFG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine?
The IUPAC name of 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine (CID 10687103) is 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine.
What is the SMILES notation for 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine?
The canonical SMILES for 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine is CN(C)CCOc1cccc2c1S(=O)(=O)c1ccccc1O2.
What is the InChIKey of 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine?
The InChIKey is WNSRLYMBOYSDFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4S/c1-17(2)10-11-20-13-7-5-8-14-16(13)22(18,19)15-9-4-3-6-12(15)21-14/h3-9H,10-11H2,1-2H3.
What are the key properties of 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine?
2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine has a molecular weight of 319.38 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(10,10-dioxophenoxathiin-1-yl)oxy-N,N-dimethylethanamine is sourced from PubChem (CID 10687103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).