C13H17N3OSe — CID 106871772
N-(3-methoxycyclohexyl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine (PubChem CID 106871772) has the molecular formula C13H17N3OSe and a molecular weight of 310.26 g/mol. Its IUPAC name is N-(3-methoxycyclohexyl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine.
| Compound Name | N-(3-methoxycyclohexyl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
|---|---|
| PubChem CID | 106871772 |
| Molecular Formula | C13H17N3OSe |
| Molecular Weight | 310.26 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-(3-methoxycyclohexyl)-8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-amine |
| SMILES | COC1CCCC(Nc2cccc3c2N=[Se]=N3)C1 |
| InChI | InChI=1S/C13H17N3OSe/c1-17-10-5-2-4-9(8-10)14-11-6-3-7-12-13(11)16-18-15-12/h3,6-7,9-10,14H,2,4-5,8H2,1H3 |
| InChIKey | CIHGELSUAJXBCU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|