C17H28N2O — CID 106872252
1-(aminomethyl)-2-methoxy-N-methyl-N-[(2-methylphenyl)methyl]cyclohexan-1-amine (PubChem CID 106872252) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(aminomethyl)-2-methoxy-N-methyl-N-[(2-methylphenyl)methyl]cyclohexan-1-amine.
| Compound Name | 1-(aminomethyl)-2-methoxy-N-methyl-N-[(2-methylphenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 106872252 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-(aminomethyl)-2-methoxy-N-methyl-N-[(2-methylphenyl)methyl]cyclohexan-1-amine |
| SMILES | COC1CCCCC1(CN)N(C)Cc1ccccc1C |
| InChI | InChI=1S/C17H28N2O/c1-14-8-4-5-9-15(14)12-19(2)17(13-18)11-7-6-10-16(17)20-3/h4-5,8-9,16H,6-7,10-13,18H2,1-3H3 |
| InChIKey | PGQUNUSXZDWXSZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |