C14H9Cl2N3O2 — CID 10687263
6,7-dichloro-5-(pyridin-2-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 10687263) has the molecular formula C14H9Cl2N3O2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 6,7-dichloro-5-(pyridin-2-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6,7-dichloro-5-(pyridin-2-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 10687263 |
| Molecular Formula | C14H9Cl2N3O2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 6,7-dichloro-5-(pyridin-2-ylmethyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc(Cl)c(Cl)c(Cc3ccccn3)c2[nH]c1=O |
| InChI | InChI=1S/C14H9Cl2N3O2/c15-9-6-10-12(19-14(21)13(20)18-10)8(11(9)16)5-7-3-1-2-4-17-7/h1-4,6H,5H2,(H,18,20)(H,19,21) |
| InChIKey | GPQNMDWGOKBGTI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|