C19H18F3N5O — CID 1068736
4-N-ethyl-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 1068736) has the molecular formula C19H18F3N5O and a molecular weight of 389.38 g/mol. Its IUPAC name is 4-N-ethyl-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 1068736 |
| Molecular Formula | C19H18F3N5O |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 4-N-ethyl-2-N,2-N-diphenyl-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(OCC(F)(F)F)nc(N(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C19H18F3N5O/c1-2-23-16-24-17(26-18(25-16)28-13-19(20,21)22)27(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,23,24,25,26) |
| InChIKey | YOHHCVFLKQDJRJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |