About [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol
[6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol (PubChem CID 10687450) has the molecular formula C22H28O2
and a molecular weight of 324.46 g/mol. Its IUPAC name is [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol.
Molecular Properties
| Compound Name | [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol |
| PubChem CID | 10687450 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol |
| SMILES | CCCC(C)(C)c1ccc2c(c1)OC(C)(C)c1ccc(CO)cc1-2 |
| InChI | InChI=1S/C22H28O2/c1-6-11-21(2,3)16-8-9-17-18-12-15(14-23)7-10-19(18)22(4,5)24-20(17)13-16/h7-10,12-13,23H,6,11,14H2,1-5H3 |
| InChIKey | WOUGNVGXCUXHJS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol?
The IUPAC name of [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol (CID 10687450) is [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol.
What is the SMILES notation for [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol?
The canonical SMILES for [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol is CCCC(C)(C)c1ccc2c(c1)OC(C)(C)c1ccc(CO)cc1-2.
What is the InChIKey of [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol?
The InChIKey is WOUGNVGXCUXHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O2/c1-6-11-21(2,3)16-8-9-17-18-12-15(14-23)7-10-19(18)22(4,5)24-20(17)13-16/h7-10,12-13,23H,6,11,14H2,1-5H3.
What are the key properties of [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol?
[6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol has a molecular weight of 324.46 g/mol, XLogP of 5.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6,6-dimethyl-3-(2-methylpentan-2-yl)benzo[c]chromen-9-yl]methanol is sourced from PubChem (CID 10687450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).