C16H23N3O — CID 106874965
6-methoxy-1-(3-methylphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 106874965) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-methoxy-1-(3-methylphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 6-methoxy-1-(3-methylphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 106874965 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 6-methoxy-1-(3-methylphenyl)-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | COC1CCCCC12CN=C(N)N2c1cccc(C)c1 |
| InChI | InChI=1S/C16H23N3O/c1-12-6-5-7-13(10-12)19-15(17)18-11-16(19)9-4-3-8-14(16)20-2/h5-7,10,14H,3-4,8-9,11H2,1-2H3,(H2,17,18) |
| InChIKey | ZWDBXMJVPFAMHS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |