C15H20FN3O — CID 106874984
1-(3-fluorophenyl)-7-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine (PubChem CID 106874984) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-7-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine.
| Compound Name | 1-(3-fluorophenyl)-7-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine |
|---|---|
| PubChem CID | 106874984 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-(3-fluorophenyl)-7-methoxy-1,3-diazaspiro[4.5]dec-2-en-2-amine |
| SMILES | COC1CCCC2(CN=C(N)N2c2cccc(F)c2)C1 |
| InChI | InChI=1S/C15H20FN3O/c1-20-13-6-3-7-15(9-13)10-18-14(17)19(15)12-5-2-4-11(16)8-12/h2,4-5,8,13H,3,6-7,9-10H2,1H3,(H2,17,18) |
| InChIKey | FJKMVRUAPNYWTR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |