C17H22F3N3 — CID 10687513
N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]propane-1,3-diamine (PubChem CID 10687513) has the molecular formula C17H22F3N3 and a molecular weight of 325.38 g/mol. Its IUPAC name is N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10687513 |
| Molecular Formula | C17H22F3N3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C17H22F3N3/c1-3-23(4-2)11-5-9-21-15-8-10-22-16-12-13(17(18,19)20)6-7-14(15)16/h6-8,10,12H,3-5,9,11H2,1-2H3,(H,21,22) |
| InChIKey | NNLNIRYGAMASQD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|