C10H12BrNO2S — CID 106875336
2-[(3-bromo-4-methyl-2-pyridinyl)sulfanyl]-2-methylpropanoic acid (PubChem CID 106875336) has the molecular formula C10H12BrNO2S and a molecular weight of 290.18 g/mol. Its IUPAC name is 2-[(3-bromo-4-methyl-2-pyridinyl)sulfanyl]-2-methylpropanoic acid.
| Compound Name | 2-[(3-bromo-4-methyl-2-pyridinyl)sulfanyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 106875336 |
| Molecular Formula | C10H12BrNO2S |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 2-[(3-bromo-4-methyl-2-pyridinyl)sulfanyl]-2-methylpropanoic acid |
| SMILES | Cc1ccnc(SC(C)(C)C(=O)O)c1Br |
| InChI | InChI=1S/C10H12BrNO2S/c1-6-4-5-12-8(7(6)11)15-10(2,3)9(13)14/h4-5H,1-3H3,(H,13,14) |
| InChIKey | UOHZIUGQDNAMHB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |