C21H27NO2 — CID 10687534
(2E,4E,6E)-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoic acid (PubChem CID 10687534) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2E,4E,6E)-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 10687534 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (2E,4E,6E)-3-methyl-7-(1-propan-2-yl-3,4-dihydro-2H-quinolin-6-yl)octa-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)c1ccc2c(c1)CCCN2C(C)C)=C\C(=O)O |
| InChI | InChI=1S/C21H27NO2/c1-15(2)22-12-6-9-19-14-18(10-11-20(19)22)17(4)8-5-7-16(3)13-21(23)24/h5,7-8,10-11,13-15H,6,9,12H2,1-4H3,(H,23,24)/b7-5+,16-13+,17-8+ |
| InChIKey | DWQUMLRPAPSXIM-OTLMWCFISA-N |
| XLogP | 4.84 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|