C13H18N3O5P — CID 10687623
[2-[(2R)-2-amino-3-ethoxy-3-oxopropyl]benzimidazol-1-yl]methylphosphonic acid (PubChem CID 10687623) has the molecular formula C13H18N3O5P and a molecular weight of 327.28 g/mol. Its IUPAC name is [2-[(2R)-2-amino-3-ethoxy-3-oxopropyl]benzimidazol-1-yl]methylphosphonic acid.
| Compound Name | [2-[(2R)-2-amino-3-ethoxy-3-oxopropyl]benzimidazol-1-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 10687623 |
| Molecular Formula | C13H18N3O5P |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | [2-[(2R)-2-amino-3-ethoxy-3-oxopropyl]benzimidazol-1-yl]methylphosphonic acid |
| SMILES | CCOC(=O)[C@H](N)Cc1nc2ccccc2n1CP(=O)(O)O |
| InChI | InChI=1S/C13H18N3O5P/c1-2-21-13(17)9(14)7-12-15-10-5-3-4-6-11(10)16(12)8-22(18,19)20/h3-6,9H,2,7-8,14H2,1H3,(H2,18,19,20)/t9-/m1/s1 |
| InChIKey | JGYXTLPJZCJUHM-SECBINFHSA-N |
| XLogP | 0.60 |
| TPSA | 127.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|