C20H25NO3 — CID 10687664
5-(3,5,5,7,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid (PubChem CID 10687664) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 5-(3,5,5,7,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid.
| Compound Name | 5-(3,5,5,7,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 10687664 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 5-(3,5,5,7,8,8-hexamethyl-6,7-dihydronaphthalen-2-yl)-1,2-oxazole-3-carboxylic acid |
| SMILES | Cc1cc2c(cc1-c1cc(C(=O)O)no1)C(C)(C)C(C)CC2(C)C |
| InChI | InChI=1S/C20H25NO3/c1-11-7-14-15(20(5,6)12(2)10-19(14,3)4)8-13(11)17-9-16(18(22)23)21-24-17/h7-9,12H,10H2,1-6H3,(H,22,23) |
| InChIKey | UWSDSQVGPVPJRF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |