C20H27NO3 — CID 10687811
(1S,2R,6S,7R)-7,10,10-trimethyl-5-non-8-en-2-ynoyl-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 10687811) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (1S,2R,6S,7R)-7,10,10-trimethyl-5-non-8-en-2-ynoyl-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one.
| Compound Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-non-8-en-2-ynoyl-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
|---|---|
| PubChem CID | 10687811 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (1S,2R,6S,7R)-7,10,10-trimethyl-5-non-8-en-2-ynoyl-3-oxa-5-azatricyclo[5.2.1.02,6]decan-4-one |
| SMILES | C=CCCCCC#CC(=O)N1C(=O)O[C@@H]2[C@H]3CC[C@@](C)([C@@H]21)C3(C)C |
| InChI | InChI=1S/C20H27NO3/c1-5-6-7-8-9-10-11-15(22)21-17-16(24-18(21)23)14-12-13-20(17,4)19(14,2)3/h5,14,16-17H,1,6-9,12-13H2,2-4H3/t14-,16-,17-,20+/m1/s1 |
| InChIKey | ZJOCRAUEKLPNJS-OYRIPWCXSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|